C13H16N4O3 — CID 66076244
4-(4-hydrazinyl-3-methylbenzoyl)-3-methylpiperazine-2,6-dione (PubChem CID 66076244) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-(4-hydrazinyl-3-methylbenzoyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(4-hydrazinyl-3-methylbenzoyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66076244 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-(4-hydrazinyl-3-methylbenzoyl)-3-methylpiperazine-2,6-dione |
| SMILES | Cc1cc(C(=O)N2CC(=O)NC(=O)C2C)ccc1NN |
| InChI | InChI=1S/C13H16N4O3/c1-7-5-9(3-4-10(7)16-14)13(20)17-6-11(18)15-12(19)8(17)2/h3-5,8,16H,6,14H2,1-2H3,(H,15,18,19) |
| InChIKey | IAKWWVGYXZLMMH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|