C12H11Cl2N3O3 — CID 66068737
4-(2,6-dichloropyridine-4-carbonyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66068737) has the molecular formula C12H11Cl2N3O3 and a molecular weight of 316.14 g/mol. Its IUPAC name is 4-(2,6-dichloropyridine-4-carbonyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(2,6-dichloropyridine-4-carbonyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66068737 |
| Molecular Formula | C12H11Cl2N3O3 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4-(2,6-dichloropyridine-4-carbonyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O3/c1-2-7-11(19)16-10(18)5-17(7)12(20)6-3-8(13)15-9(14)4-6/h3-4,7H,2,5H2,1H3,(H,16,18,19) |
| InChIKey | DORIEWBFEDKXAV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|