C8H11ClN2O3 — CID 66068113
4-(2-chloroacetyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66068113) has the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. Its IUPAC name is 4-(2-chloroacetyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(2-chloroacetyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66068113 |
| Molecular Formula | C8H11ClN2O3 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-(2-chloroacetyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)CCl |
| InChI | InChI=1S/C8H11ClN2O3/c1-2-5-8(14)10-6(12)4-11(5)7(13)3-9/h5H,2-4H2,1H3,(H,10,12,14) |
| InChIKey | OTLZMYREGMIZMQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|