C8H13N3O3 — CID 66069530
4-(2-aminoacetyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66069530) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-(2-aminoacetyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(2-aminoacetyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069530 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-(2-aminoacetyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)CN |
| InChI | InChI=1S/C8H13N3O3/c1-2-5-8(14)10-6(12)4-11(5)7(13)3-9/h5H,2-4,9H2,1H3,(H,10,12,14) |
| InChIKey | FANLNIKAQSLFID-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|