C10H14N2O4 — CID 66069309
prop-2-enyl 2-ethyl-3,5-dioxopiperazine-1-carboxylate (PubChem CID 66069309) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is prop-2-enyl 2-ethyl-3,5-dioxopiperazine-1-carboxylate.
| Compound Name | prop-2-enyl 2-ethyl-3,5-dioxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 66069309 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | prop-2-enyl 2-ethyl-3,5-dioxopiperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(=O)NC(=O)C1CC |
| InChI | InChI=1S/C10H14N2O4/c1-3-5-16-10(15)12-6-8(13)11-9(14)7(12)4-2/h3,7H,1,4-6H2,2H3,(H,11,13,14) |
| InChIKey | SYBBWXNRQFTQLI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|