C12H21N3O3 — CID 66069151
4-[(2S)-2-amino-3,3-dimethylbutanoyl]-3-ethylpiperazine-2,6-dione (PubChem CID 66069151) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3,3-dimethylbutanoyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-[(2S)-2-amino-3,3-dimethylbutanoyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069151 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-[(2S)-2-amino-3,3-dimethylbutanoyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C12H21N3O3/c1-5-7-10(17)14-8(16)6-15(7)11(18)9(13)12(2,3)4/h7,9H,5-6,13H2,1-4H3,(H,14,16,17)/t7?,9-/m1/s1 |
| InChIKey | RVTKJSPWFPCQEG-NHSZFOGYSA-N |
| XLogP | -0.38 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|