C14H17N3O3 — CID 66069529
4-(2-amino-2-phenylacetyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66069529) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-(2-amino-2-phenylacetyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(2-amino-2-phenylacetyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069529 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-(2-amino-2-phenylacetyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)C(N)c1ccccc1 |
| InChI | InChI=1S/C14H17N3O3/c1-2-10-13(19)16-11(18)8-17(10)14(20)12(15)9-6-4-3-5-7-9/h3-7,10,12H,2,8,15H2,1H3,(H,16,18,19) |
| InChIKey | MOGSWDBDWSTEFT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|