C11H19N3O5S — CID 66068962
4-(2-amino-4-methylsulfonylbutanoyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66068962) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4-(2-amino-4-methylsulfonylbutanoyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(2-amino-4-methylsulfonylbutanoyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66068962 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-(2-amino-4-methylsulfonylbutanoyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C11H19N3O5S/c1-3-8-10(16)13-9(15)6-14(8)11(17)7(12)4-5-20(2,18)19/h7-8H,3-6,12H2,1-2H3,(H,13,15,16) |
| InChIKey | HJNIQJCWYQAYMF-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|