C9H13N3O3S — CID 66069349
3-(2-ethyl-3,5-dioxopiperazin-1-yl)-3-oxopropanethioamide (PubChem CID 66069349) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 3-(2-ethyl-3,5-dioxopiperazin-1-yl)-3-oxopropanethioamide.
| Compound Name | 3-(2-ethyl-3,5-dioxopiperazin-1-yl)-3-oxopropanethioamide |
|---|---|
| PubChem CID | 66069349 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-(2-ethyl-3,5-dioxopiperazin-1-yl)-3-oxopropanethioamide |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)CC(N)=S |
| InChI | InChI=1S/C9H13N3O3S/c1-2-5-9(15)11-7(13)4-12(5)8(14)3-6(10)16/h5H,2-4H2,1H3,(H2,10,16)(H,11,13,15) |
| InChIKey | YXEVTSKPLAMXLK-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|