About 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid
4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid (PubChem CID 66067143) has the molecular formula C10H14N2O5
and a molecular weight of 242.23 g/mol. Its IUPAC name is 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid |
| PubChem CID | 66067143 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)CCC(=O)O |
| InChI | InChI=1S/C10H14N2O5/c1-2-6-10(17)11-7(13)5-12(6)8(14)3-4-9(15)16/h6H,2-5H2,1H3,(H,15,16)(H,11,13,17) |
| InChIKey | UNBMFOBEPZYXAS-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid?
The IUPAC name of 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid (CID 66067143) is 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid.
What is the SMILES notation for 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid?
The canonical SMILES for 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid is CCC1C(=O)NC(=O)CN1C(=O)CCC(=O)O.
What is the InChIKey of 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid?
The InChIKey is UNBMFOBEPZYXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O5/c1-2-6-10(17)11-7(13)5-12(6)8(14)3-4-9(15)16/h6H,2-5H2,1H3,(H,15,16)(H,11,13,17).
What are the key properties of 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid?
4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid has a molecular weight of 242.23 g/mol, XLogP of -0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-4-oxobutanoic acid is sourced from PubChem (CID 66067143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).