C12H19N3O3 — CID 79854148
4-[2-(1-aminocyclobutyl)acetyl]-3-ethylpiperazine-2,6-dione (PubChem CID 79854148) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-[2-(1-aminocyclobutyl)acetyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-[2-(1-aminocyclobutyl)acetyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 79854148 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-[2-(1-aminocyclobutyl)acetyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)CC1(N)CCC1 |
| InChI | InChI=1S/C12H19N3O3/c1-2-8-11(18)14-9(16)7-15(8)10(17)6-12(13)4-3-5-12/h8H,2-7,13H2,1H3,(H,14,16,18) |
| InChIKey | GYTGXSOBMXYZGQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|