C10H14N4O4S — CID 66069159
N-(2-amino-2-sulfanylideneethyl)-2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetamide (PubChem CID 66069159) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 66069159 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-2-(2-ethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetamide |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C10H14N4O4S/c1-2-5-8(16)13-7(15)4-14(5)10(18)9(17)12-3-6(11)19/h5H,2-4H2,1H3,(H2,11,19)(H,12,17)(H,13,15,16) |
| InChIKey | XDCIDYXZAJFTIT-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|