C12H21N3O2S — CID 66069276
4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide (PubChem CID 66069276) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide.
| Compound Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 66069276 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-(2-ethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylbutanethioamide |
| SMILES | CCC1C(=O)NC(=O)CN1CCC(C)(C)C(N)=S |
| InChI | InChI=1S/C12H21N3O2S/c1-4-8-10(17)14-9(16)7-15(8)6-5-12(2,3)11(13)18/h8H,4-7H2,1-3H3,(H2,13,18)(H,14,16,17) |
| InChIKey | NOKIXFXMXFCDBY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|