C8H11N3O2 — CID 66067150
2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetonitrile (PubChem CID 66067150) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetonitrile.
| Compound Name | 2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 66067150 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-(2-ethyl-3,5-dioxopiperazin-1-yl)acetonitrile |
| SMILES | CCC1C(=O)NC(=O)CN1CC#N |
| InChI | InChI=1S/C8H11N3O2/c1-2-6-8(13)10-7(12)5-11(6)4-3-9/h6H,2,4-5H2,1H3,(H,10,12,13) |
| InChIKey | WJQCEVZUDGDYNQ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|