C6H11N3O4S — CID 66067408
2-ethyl-3,5-dioxopiperazine-1-sulfonamide (PubChem CID 66067408) has the molecular formula C6H11N3O4S and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-ethyl-3,5-dioxopiperazine-1-sulfonamide.
| Compound Name | 2-ethyl-3,5-dioxopiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 66067408 |
| Molecular Formula | C6H11N3O4S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-ethyl-3,5-dioxopiperazine-1-sulfonamide |
| SMILES | CCC1C(=O)NC(=O)CN1S(N)(=O)=O |
| InChI | InChI=1S/C6H11N3O4S/c1-2-4-6(11)8-5(10)3-9(4)14(7,12)13/h4H,2-3H2,1H3,(H2,7,12,13)(H,8,10,11) |
| InChIKey | BFOZBJZELQWFBI-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|