C12H17N3O4S2 — CID 66068399
4-[5-(2-aminoethyl)thiophen-2-yl]sulfonyl-3-ethylpiperazine-2,6-dione (PubChem CID 66068399) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-[5-(2-aminoethyl)thiophen-2-yl]sulfonyl-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-[5-(2-aminoethyl)thiophen-2-yl]sulfonyl-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66068399 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-[5-(2-aminoethyl)thiophen-2-yl]sulfonyl-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1S(=O)(=O)c1ccc(CCN)s1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-2-9-12(17)14-10(16)7-15(9)21(18,19)11-4-3-8(20-11)5-6-13/h3-4,9H,2,5-7,13H2,1H3,(H,14,16,17) |
| InChIKey | JAXQIFLSVOEUBK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|