C11H14N4O4S — CID 66069947
4-[(2-amino-4-pyridinyl)sulfonyl]-3-ethylpiperazine-2,6-dione (PubChem CID 66069947) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-[(2-amino-4-pyridinyl)sulfonyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-[(2-amino-4-pyridinyl)sulfonyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069947 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-[(2-amino-4-pyridinyl)sulfonyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1S(=O)(=O)c1ccnc(N)c1 |
| InChI | InChI=1S/C11H14N4O4S/c1-2-8-11(17)14-10(16)6-15(8)20(18,19)7-3-4-13-9(12)5-7/h3-5,8H,2,6H2,1H3,(H2,12,13)(H,14,16,17) |
| InChIKey | FUGZKRABKABLAK-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|