C12H13ClN2O4S — CID 66070097
4-(3-chlorophenyl)sulfonyl-3-ethylpiperazine-2,6-dione (PubChem CID 66070097) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is 4-(3-chlorophenyl)sulfonyl-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(3-chlorophenyl)sulfonyl-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66070097 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-(3-chlorophenyl)sulfonyl-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O4S/c1-2-10-12(17)14-11(16)7-15(10)20(18,19)9-5-3-4-8(13)6-9/h3-6,10H,2,7H2,1H3,(H,14,16,17) |
| InChIKey | LPWIZYAJBTVBRX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|