C10H13ClN2O3S2 — CID 63601203
4-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperazin-2-one (PubChem CID 63601203) has the molecular formula C10H13ClN2O3S2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperazin-2-one.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 63601203 |
| Molecular Formula | C10H13ClN2O3S2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H13ClN2O3S2/c1-2-7-10(14)12-5-6-13(7)18(15,16)9-4-3-8(11)17-9/h3-4,7H,2,5-6H2,1H3,(H,12,14) |
| InChIKey | IFHPIJZVMIJADK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |