C12H16ClN3O3S2 — CID 146074098
9-(5-chlorothiophen-2-yl)sulfonyl-2,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepin-1-one (PubChem CID 146074098) has the molecular formula C12H16ClN3O3S2 and a molecular weight of 349.87 g/mol. Its IUPAC name is 9-(5-chlorothiophen-2-yl)sulfonyl-2,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepin-1-one.
| Compound Name | 9-(5-chlorothiophen-2-yl)sulfonyl-2,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepin-1-one |
|---|---|
| PubChem CID | 146074098 |
| Molecular Formula | C12H16ClN3O3S2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 9-(5-chlorothiophen-2-yl)sulfonyl-2,3,4,6,7,8,10,10a-octahydropyrazino[1,2-a][1,4]diazepin-1-one |
| SMILES | O=C1NCCN2CCCN(S(=O)(=O)c3ccc(Cl)s3)CC12 |
| InChI | InChI=1S/C12H16ClN3O3S2/c13-10-2-3-11(20-10)21(18,19)16-6-1-5-15-7-4-14-12(17)9(15)8-16/h2-3,9H,1,4-8H2,(H,14,17) |
| InChIKey | PFMFHBWQYJCLOO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |