C10H12N2O5S2 — CID 63607534
5-(2-methyl-3-oxopiperazin-1-yl)sulfonylthiophene-2-carboxylic acid (PubChem CID 63607534) has the molecular formula C10H12N2O5S2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5-(2-methyl-3-oxopiperazin-1-yl)sulfonylthiophene-2-carboxylic acid.
| Compound Name | 5-(2-methyl-3-oxopiperazin-1-yl)sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63607534 |
| Molecular Formula | C10H12N2O5S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5-(2-methyl-3-oxopiperazin-1-yl)sulfonylthiophene-2-carboxylic acid |
| SMILES | CC1C(=O)NCCN1S(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C10H12N2O5S2/c1-6-9(13)11-4-5-12(6)19(16,17)8-3-2-7(18-8)10(14)15/h2-3,6H,4-5H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | GVAKVWQEHCUWBC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |