C11H14N2O5S2 — CID 61028177
5-[2-(methylcarbamoyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylic acid (PubChem CID 61028177) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 5-[2-(methylcarbamoyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylic acid.
| Compound Name | 5-[2-(methylcarbamoyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61028177 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 5-[2-(methylcarbamoyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylic acid |
| SMILES | CNC(=O)C1CCCN1S(=O)(=O)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C11H14N2O5S2/c1-12-10(14)7-3-2-6-13(7)20(17,18)9-5-4-8(19-9)11(15)16/h4-5,7H,2-3,6H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | OYPUCJGWQARKBN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |