C12H16N2O5S2 — CID 61027124
5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylic acid (PubChem CID 61027124) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylic acid.
| Compound Name | 5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61027124 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-[4-(methylcarbamoyl)piperidin-1-yl]sulfonylthiophene-2-carboxylic acid |
| SMILES | CNC(=O)C1CCN(S(=O)(=O)c2ccc(C(=O)O)s2)CC1 |
| InChI | InChI=1S/C12H16N2O5S2/c1-13-11(15)8-4-6-14(7-5-8)21(18,19)10-3-2-9(20-10)12(16)17/h2-3,8H,4-7H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | SDETVSOAKQQMSD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |