C9H11NO4S2 — CID 61027232
5-pyrrolidin-1-ylsulfonylthiophene-2-carboxylic acid (PubChem CID 61027232) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-pyrrolidin-1-ylsulfonylthiophene-2-carboxylic acid.
| Compound Name | 5-pyrrolidin-1-ylsulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61027232 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 5-pyrrolidin-1-ylsulfonylthiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C9H11NO4S2/c11-9(12)7-3-4-8(15-7)16(13,14)10-5-1-2-6-10/h3-4H,1-2,5-6H2,(H,11,12) |
| InChIKey | BQPNPKIULBVJLK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |