C18H18ClNO4S2 — CID 2421365
(E)-3-(2-chlorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid (PubChem CID 2421365) has the molecular formula C18H18ClNO4S2 and a molecular weight of 411.93 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-chlorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 2421365 |
| Molecular Formula | C18H18ClNO4S2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1Cl)c1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C18H18ClNO4S2/c19-15-7-3-2-6-13(15)12-14(18(21)22)16-8-9-17(25-16)26(23,24)20-10-4-1-5-11-20/h2-3,6-9,12H,1,4-5,10-11H2,(H,21,22)/b14-12- |
| InChIKey | WOWNJYCKJCOVOH-OWBHPGMISA-N |
| XLogP | 4.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|