C19H21NO5S2 — CID 6529764
(E)-3-(2-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid (PubChem CID 6529764) has the molecular formula C19H21NO5S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6529764 |
| Molecular Formula | C19H21NO5S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
| SMILES | COc1ccccc1/C=C(\C(=O)O)c1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C19H21NO5S2/c1-25-16-8-4-3-7-14(16)13-15(19(21)22)17-9-10-18(26-17)27(23,24)20-11-5-2-6-12-20/h3-4,7-10,13H,2,5-6,11-12H2,1H3,(H,21,22)/b15-13- |
| InChIKey | MOEGPHCEGLYBOJ-SQFISAMPSA-N |
| XLogP | 3.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|