C18H18N2O6S2 — CID 3287629
3-(3-nitrophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid (PubChem CID 3287629) has the molecular formula C18H18N2O6S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid.
| Compound Name | 3-(3-nitrophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 3287629 |
| Molecular Formula | C18H18N2O6S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 3-(3-nitrophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1cccc([N+](=O)[O-])c1)c1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C18H18N2O6S2/c21-18(22)15(12-13-5-4-6-14(11-13)20(23)24)16-7-8-17(27-16)28(25,26)19-9-2-1-3-10-19/h4-8,11-12H,1-3,9-10H2,(H,21,22) |
| InChIKey | KMFDXZIDYUEZPT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|