C17H18N2O4S2 — CID 2381988
(Z)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-pyridin-4-ylprop-2-enoic acid (PubChem CID 2381988) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (Z)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-pyridin-4-ylprop-2-enoic acid.
| Compound Name | (Z)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-pyridin-4-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 2381988 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (Z)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-pyridin-4-ylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1ccncc1)c1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C17H18N2O4S2/c20-17(21)14(12-13-6-8-18-9-7-13)15-4-5-16(24-15)25(22,23)19-10-2-1-3-11-19/h4-9,12H,1-3,10-11H2,(H,20,21)/b14-12+ |
| InChIKey | CMMMTDQFSFZBEH-WYMLVPIESA-N |
| XLogP | 2.94 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|