C20H21NO5S2 — CID 9447182
(E)-3-(2-prop-2-enoxyphenyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid (PubChem CID 9447182) has the molecular formula C20H21NO5S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is (E)-3-(2-prop-2-enoxyphenyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-prop-2-enoxyphenyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 9447182 |
| Molecular Formula | C20H21NO5S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (E)-3-(2-prop-2-enoxyphenyl)-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
| SMILES | C=CCOc1ccccc1/C=C(\C(=O)O)c1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C20H21NO5S2/c1-2-13-26-17-8-4-3-7-15(17)14-16(20(22)23)18-9-10-19(27-18)28(24,25)21-11-5-6-12-21/h2-4,7-10,14H,1,5-6,11-13H2,(H,22,23)/b16-14- |
| InChIKey | DFHQTWOQXFBAJI-PEZBUJJGSA-N |
| XLogP | 3.72 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|