C21H23NO5S2 — CID 3651804
2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid (PubChem CID 3651804) has the molecular formula C21H23NO5S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 3651804 |
| Molecular Formula | C21H23NO5S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-3-(4-prop-2-enoxyphenyl)prop-2-enoic acid |
| SMILES | C=CCOc1ccc(C=C(C(=O)O)c2ccc(S(=O)(=O)N3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C21H23NO5S2/c1-2-14-27-17-8-6-16(7-9-17)15-18(21(23)24)19-10-11-20(28-19)29(25,26)22-12-4-3-5-13-22/h2,6-11,15H,1,3-5,12-14H2,(H,23,24) |
| InChIKey | AYOWUHXFJZVEOF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|