C18H18FNO4S2 — CID 2487944
(Z)-3-(3-fluorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid (PubChem CID 2487944) has the molecular formula C18H18FNO4S2 and a molecular weight of 395.48 g/mol. Its IUPAC name is (Z)-3-(3-fluorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3-fluorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 2487944 |
| Molecular Formula | C18H18FNO4S2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | (Z)-3-(3-fluorophenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1cccc(F)c1)c1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C18H18FNO4S2/c19-14-6-4-5-13(11-14)12-15(18(21)22)16-7-8-17(25-16)26(23,24)20-9-2-1-3-10-20/h4-8,11-12H,1-3,9-10H2,(H,21,22)/b15-12+ |
| InChIKey | RECPHKWEEKRATO-NTCAYCPXSA-N |
| XLogP | 3.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|