C18H18NO5S2- — CID 54702650
3-[(E)-2-carboxy-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethenyl]phenolate (PubChem CID 54702650) has the molecular formula C18H18NO5S2- and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-[(E)-2-carboxy-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethenyl]phenolate.
| Compound Name | 3-[(E)-2-carboxy-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethenyl]phenolate |
|---|---|
| PubChem CID | 54702650 |
| Molecular Formula | C18H18NO5S2- |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 3-[(E)-2-carboxy-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)ethenyl]phenolate |
| SMILES | O=C(O)/C(=C\c1cccc([O-])c1)c1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C18H19NO5S2/c20-14-6-4-5-13(11-14)12-15(18(21)22)16-7-8-17(25-16)26(23,24)19-9-2-1-3-10-19/h4-8,11-12,20H,1-3,9-10H2,(H,21,22)/p-1/b15-12- |
| InChIKey | QVFYEGQOJRSUEA-QINSGFPZSA-M |
| XLogP | 2.62 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|