C12H17BrN2O3S2 — CID 32836178
(2R)-1-(5-bromothiophen-2-yl)sulfonyl-N-propylpyrrolidine-2-carboxamide (PubChem CID 32836178) has the molecular formula C12H17BrN2O3S2 and a molecular weight of 381.32 g/mol. Its IUPAC name is (2R)-1-(5-bromothiophen-2-yl)sulfonyl-N-propylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(5-bromothiophen-2-yl)sulfonyl-N-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 32836178 |
| Molecular Formula | C12H17BrN2O3S2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | (2R)-1-(5-bromothiophen-2-yl)sulfonyl-N-propylpyrrolidine-2-carboxamide |
| SMILES | CCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H17BrN2O3S2/c1-2-7-14-12(16)9-4-3-8-15(9)20(17,18)11-6-5-10(13)19-11/h5-6,9H,2-4,7-8H2,1H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | YFCVHUMJAKEHOK-SECBINFHSA-N |
| XLogP | 2.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |