C16H17BrN2O3S3 — CID 24627635
1-(5-bromothiophen-2-yl)sulfonyl-N-(4-methylsulfanylphenyl)pyrrolidine-2-carboxamide (PubChem CID 24627635) has the molecular formula C16H17BrN2O3S3 and a molecular weight of 461.43 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-methylsulfanylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-methylsulfanylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24627635 |
| Molecular Formula | C16H17BrN2O3S3 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 459.96 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(4-methylsulfanylphenyl)pyrrolidine-2-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CCCN2S(=O)(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C16H17BrN2O3S3/c1-23-12-6-4-11(5-7-12)18-16(20)13-3-2-10-19(13)25(21,22)15-9-8-14(17)24-15/h4-9,13H,2-3,10H2,1H3,(H,18,20) |
| InChIKey | YNGSSGANBTXDEQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |