C17H17BrN4O3S2 — CID 166188077
1-(5-bromothiophen-2-yl)sulfonyl-N-(1H-indazol-6-yl)piperidine-2-carboxamide (PubChem CID 166188077) has the molecular formula C17H17BrN4O3S2 and a molecular weight of 469.39 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-N-(1H-indazol-6-yl)piperidine-2-carboxamide.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(1H-indazol-6-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 166188077 |
| Molecular Formula | C17H17BrN4O3S2 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-N-(1H-indazol-6-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)C1CCCCN1S(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H17BrN4O3S2/c18-15-6-7-16(26-15)27(24,25)22-8-2-1-3-14(22)17(23)20-12-5-4-11-10-19-21-13(11)9-12/h4-7,9-10,14H,1-3,8H2,(H,19,21)(H,20,23) |
| InChIKey | UMNDKKMHSNJRGA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |