C15H17N3O — CID 136529699
N-(1H-indazol-6-yl)bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 136529699) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | N-(1H-indazol-6-yl)bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 136529699 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-(1H-indazol-6-yl)bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)C1C2CCCCC21 |
| InChI | InChI=1S/C15H17N3O/c19-15(14-11-3-1-2-4-12(11)14)17-10-6-5-9-8-16-18-13(9)7-10/h5-8,11-12,14H,1-4H2,(H,16,18)(H,17,19) |
| InChIKey | UCVGFYUQCBHZDX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |