C20H27N7O2 — CID 20690484
1-(1H-indazol-6-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine (PubChem CID 20690484) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-(1H-indazol-6-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine.
| Compound Name | 1-(1H-indazol-6-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
|---|---|
| PubChem CID | 20690484 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 1-(1H-indazol-6-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
| SMILES | N/C(=N\C1CCCCN(CC(=O)N2CCCC2)C1=O)Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C20H27N7O2/c21-20(23-15-7-6-14-12-22-25-17(14)11-15)24-16-5-1-2-10-27(19(16)29)13-18(28)26-8-3-4-9-26/h6-7,11-12,16H,1-5,8-10,13H2,(H,22,25)(H3,21,23,24) |
| InChIKey | YBDBVVXRZSJRLZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|