C21H29N5O5 — CID 90993230
N-(4-methoxyphenyl)-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide (PubChem CID 90993230) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide.
| Compound Name | N-(4-methoxyphenyl)-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide |
|---|---|
| PubChem CID | 90993230 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-(4-methoxyphenyl)-2-nitro-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]ethanimidamide |
| SMILES | COc1ccc(N/C(C[N+](=O)[O-])=N/C2CCCCN(CC(=O)N3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H29N5O5/c1-31-17-9-7-16(8-10-17)22-19(14-26(29)30)23-18-6-2-3-13-25(21(18)28)15-20(27)24-11-4-5-12-24/h7-10,18H,2-6,11-15H2,1H3,(H,22,23) |
| InChIKey | KMJLGLYPMVLWMF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|