C23H32N6O3 — CID 59969947
1-cyano-2-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 59969947) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 1-cyano-2-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 1-cyano-2-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 59969947 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-cyano-2-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(=N/[C@H]2CCCCN(CC(=O)N3CCCC3)C2=O)NC#N)cc1 |
| InChI | InChI=1S/C23H32N6O3/c1-17(2)32-19-10-8-18(9-11-19)26-23(25-16-24)27-20-7-3-4-14-29(22(20)31)15-21(30)28-12-5-6-13-28/h8-11,17,20H,3-7,12-15H2,1-2H3,(H2,25,26,27)/t20-/m0/s1 |
| InChIKey | HBSXPVNRQAFGCZ-FQEVSTJZSA-N |
| XLogP | 2.32 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|