C25H31N5O5 — CID 20691285
N-[N-(4-methoxyphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide (PubChem CID 20691285) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[N-(4-methoxyphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide.
| Compound Name | N-[N-(4-methoxyphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20691285 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N-[N-(4-methoxyphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide |
| SMILES | COc1ccc(N/C(=N\C2CCCCN(CC(=O)N3CCCC3)C2=O)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C25H31N5O5/c1-34-19-11-9-18(10-12-19)26-25(28-23(32)21-8-6-16-35-21)27-20-7-2-3-15-30(24(20)33)17-22(31)29-13-4-5-14-29/h6,8-12,16,20H,2-5,7,13-15,17H2,1H3,(H2,26,27,28,32) |
| InChIKey | URCKOGSNRHGHRG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|