C25H31N5O4 — CID 20691342
N-[N-(3-methylphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide (PubChem CID 20691342) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[N-(3-methylphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide.
| Compound Name | N-[N-(3-methylphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20691342 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-[N-(3-methylphenyl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]furan-2-carboxamide |
| SMILES | Cc1cccc(N/C(=N/C2CCCCN(CC(=O)N3CCCC3)C2=O)NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C25H31N5O4/c1-18-8-6-9-19(16-18)26-25(28-23(32)21-11-7-15-34-21)27-20-10-2-3-14-30(24(20)33)17-22(31)29-12-4-5-13-29/h6-9,11,15-16,20H,2-5,10,12-14,17H2,1H3,(H2,26,27,28,32) |
| InChIKey | BCLIVVBKFYLMHS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|