C41H52BrN9O3 — CID 158786312
1-(4-benzylpiperazin-1-yl)-2-bromoethanone;2-[1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(3-methylphenyl)guanidine (PubChem CID 158786312) has the molecular formula C41H52BrN9O3 and a molecular weight of 798.83 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-bromoethanone;2-[1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(3-methylphenyl)guanidine.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-bromoethanone;2-[1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(3-methylphenyl)guanidine |
|---|---|
| PubChem CID | 158786312 |
| Molecular Formula | C41H52BrN9O3 |
| Molecular Weight | 798.83 g/mol |
| Exact Mass | 797.34 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-bromoethanone;2-[1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-1-cyano-3-(3-methylphenyl)guanidine |
| SMILES | Cc1cccc(N/C(=N/C2CCCCN(CC(=O)N3CCN(Cc4ccccc4)CC3)C2=O)NC#N)c1.O=C(CBr)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H35N7O2.C13H17BrN2O/c1-22-8-7-11-24(18-22)31-28(30-21-29)32-25-12-5-6-13-35(27(25)37)20-26(36)34-16-14-33(15-17-34)19-23-9-3-2-4-10-23;14-10-13(17)16-8-6-15(7-9-16)11-12-4-2-1-3-5-12/h2-4,7-11,18,25H,5-6,12-17,19-20H2,1H3,(H2,30,31,32);1-5H,6-11H2 |
| InChIKey | IRSONDLKZHKMLO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|