C31H39N7O4 — CID 20690988
1-[4-(dimethylamino)phenyl]-3-[N-(2-methyl-1-benzofuran-5-yl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]urea (PubChem CID 20690988) has the molecular formula C31H39N7O4 and a molecular weight of 573.70 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[N-(2-methyl-1-benzofuran-5-yl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]urea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[N-(2-methyl-1-benzofuran-5-yl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 20690988 |
| Molecular Formula | C31H39N7O4 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[N-(2-methyl-1-benzofuran-5-yl)-N'-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]urea |
| SMILES | Cc1cc2cc(N/C(=N/C3CCCCN(CC(=O)N4CCCC4)C3=O)NC(=O)Nc3ccc(N(C)C)cc3)ccc2o1 |
| InChI | InChI=1S/C31H39N7O4/c1-21-18-22-19-24(11-14-27(22)42-21)32-30(35-31(41)33-23-9-12-25(13-10-23)36(2)3)34-26-8-4-5-17-38(29(26)40)20-28(39)37-15-6-7-16-37/h9-14,18-19,26H,4-8,15-17,20H2,1-3H3,(H3,32,33,34,35,41) |
| InChIKey | DBMMQUOCYFVUIM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|