C26H31N7O3 — CID 20690525
1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-pyrazin-2-ylguanidine (PubChem CID 20690525) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is 1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-pyrazin-2-ylguanidine.
| Compound Name | 1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-pyrazin-2-ylguanidine |
|---|---|
| PubChem CID | 20690525 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-pyrazin-2-ylguanidine |
| SMILES | Cc1cc2cc(N/C(=N/C3CCCCN(CC(=O)N4CCCC4)C3=O)Nc3cnccn3)ccc2o1 |
| InChI | InChI=1S/C26H31N7O3/c1-18-14-19-15-20(7-8-22(19)36-18)29-26(31-23-16-27-9-10-28-23)30-21-6-2-3-13-33(25(21)35)17-24(34)32-11-4-5-12-32/h7-10,14-16,21H,2-6,11-13,17H2,1H3,(H2,28,29,30,31) |
| InChIKey | FKAGWOWSSXUKCW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|