C27H33N7O3 — CID 20690710
1-(6-amino-2-pyridinyl)-3-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine (PubChem CID 20690710) has the molecular formula C27H33N7O3 and a molecular weight of 503.61 g/mol. Its IUPAC name is 1-(6-amino-2-pyridinyl)-3-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine.
| Compound Name | 1-(6-amino-2-pyridinyl)-3-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
|---|---|
| PubChem CID | 20690710 |
| Molecular Formula | C27H33N7O3 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 1-(6-amino-2-pyridinyl)-3-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]guanidine |
| SMILES | Cc1cc2cc(N/C(=N/C3CCCCN(CC(=O)N4CCCC4)C3=O)Nc3cccc(N)n3)ccc2o1 |
| InChI | InChI=1S/C27H33N7O3/c1-18-15-19-16-20(10-11-22(19)37-18)29-27(32-24-9-6-8-23(28)31-24)30-21-7-2-3-14-34(26(21)36)17-25(35)33-12-4-5-13-33/h6,8-11,15-16,21H,2-5,7,12-14,17H2,1H3,(H4,28,29,30,31,32) |
| InChIKey | SVZSXGWKXXTHOC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|