C25H30N6O3S — CID 20690529
1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(1,3-thiazol-2-yl)guanidine (PubChem CID 20690529) has the molecular formula C25H30N6O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(1,3-thiazol-2-yl)guanidine.
| Compound Name | 1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 20690529 |
| Molecular Formula | C25H30N6O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 1-(2-methyl-1-benzofuran-5-yl)-2-[2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]-3-(1,3-thiazol-2-yl)guanidine |
| SMILES | Cc1cc2cc(N/C(=N/C3CCCCN(CC(=O)N4CCCC4)C3=O)Nc3nccs3)ccc2o1 |
| InChI | InChI=1S/C25H30N6O3S/c1-17-14-18-15-19(7-8-21(18)34-17)27-24(29-25-26-9-13-35-25)28-20-6-2-3-12-31(23(20)33)16-22(32)30-10-4-5-11-30/h7-9,13-15,20H,2-6,10-12,16H2,1H3,(H2,26,27,28,29) |
| InChIKey | PXUQAVVKQZCWMD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|