C28H33N6O5+ — CID 59969841
1-hydroxy-N-[N-(2-methyl-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]pyridin-1-ium-3-carboxamide (PubChem CID 59969841) has the molecular formula C28H33N6O5+ and a molecular weight of 533.61 g/mol. Its IUPAC name is 1-hydroxy-N-[N-(2-methyl-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-hydroxy-N-[N-(2-methyl-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 59969841 |
| Molecular Formula | C28H33N6O5+ |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 1-hydroxy-N-[N-(2-methyl-1-benzofuran-5-yl)-N'-[(3S)-2-oxo-1-(2-oxo-2-pyrrolidin-1-ylethyl)azepan-3-yl]carbamimidoyl]pyridin-1-ium-3-carboxamide |
| SMILES | Cc1cc2cc(N/C(=N/[C@H]3CCCCN(CC(=O)N4CCCC4)C3=O)NC(=O)c3ccc[n+](O)c3)ccc2o1 |
| InChI | InChI=1S/C28H32N6O5/c1-19-15-21-16-22(9-10-24(21)39-19)29-28(31-26(36)20-7-6-14-34(38)17-20)30-23-8-2-3-13-33(27(23)37)18-25(35)32-11-4-5-12-32/h6-7,9-10,14-17,23H,2-5,8,11-13,18H2,1H3,(H2-,29,30,31,36,38)/p+1/t23-/m0/s1 |
| InChIKey | YRNKKYWHCJEDQY-QHCPKHFHSA-O |
| XLogP | 2.47 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|