C29H32N6O4 — CID 59969809
1-cyano-2-[(3S)-1-[2-(8-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine (PubChem CID 59969809) has the molecular formula C29H32N6O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is 1-cyano-2-[(3S)-1-[2-(8-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine.
| Compound Name | 1-cyano-2-[(3S)-1-[2-(8-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 59969809 |
| Molecular Formula | C29H32N6O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 1-cyano-2-[(3S)-1-[2-(8-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine |
| SMILES | COc1cccc2c1CN(C(=O)CN1CCCC[C@H](/N=C(\NC#N)Nc3ccc4oc(C)cc4c3)C1=O)CC2 |
| InChI | InChI=1S/C29H32N6O4/c1-19-14-21-15-22(9-10-25(21)39-19)32-29(31-18-30)33-24-7-3-4-12-35(28(24)37)17-27(36)34-13-11-20-6-5-8-26(38-2)23(20)16-34/h5-6,8-10,14-15,24H,3-4,7,11-13,16-17H2,1-2H3,(H2,31,32,33)/t24-/m0/s1 |
| InChIKey | JXZRKXDQDXYTJP-DEOSSOPVSA-N |
| XLogP | 3.55 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|