C28H34N6O4 — CID 59969958
1-cyano-2-[1-[2-[(7S)-7-methyl-3,3a,4,5,6,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine (PubChem CID 59969958) has the molecular formula C28H34N6O4 and a molecular weight of 518.62 g/mol. Its IUPAC name is 1-cyano-2-[1-[2-[(7S)-7-methyl-3,3a,4,5,6,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine.
| Compound Name | 1-cyano-2-[1-[2-[(7S)-7-methyl-3,3a,4,5,6,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine |
|---|---|
| PubChem CID | 59969958 |
| Molecular Formula | C28H34N6O4 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 1-cyano-2-[1-[2-[(7S)-7-methyl-3,3a,4,5,6,7a-hexahydro-1H-4,7-epoxyisoindol-2-yl]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(2-methyl-1-benzofuran-5-yl)guanidine |
| SMILES | Cc1cc2cc(N/C(=N/C3CCCCN(CC(=O)N4CC5C6CC[C@](C)(O6)C5C4)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C28H34N6O4/c1-17-11-18-12-19(6-7-23(18)37-17)31-27(30-16-29)32-22-5-3-4-10-33(26(22)36)15-25(35)34-13-20-21(14-34)28(2)9-8-24(20)38-28/h6-7,11-12,20-22,24H,3-5,8-10,13-15H2,1-2H3,(H2,30,31,32)/t20?,21?,22?,24?,28-/m0/s1 |
| InChIKey | NOOZMKCOWLDVLH-LUDDOLHUSA-N |
| XLogP | 2.99 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|