C29H34N6O3 — CID 59969822
2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-(4-phenylbutyl)acetamide (PubChem CID 59969822) has the molecular formula C29H34N6O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-(4-phenylbutyl)acetamide.
| Compound Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-(4-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 59969822 |
| Molecular Formula | C29H34N6O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2-[(3S)-3-[[(cyanoamino)-[(2-methyl-1-benzofuran-5-yl)amino]methylidene]amino]-2-oxoazepan-1-yl]-N-(4-phenylbutyl)acetamide |
| SMILES | Cc1cc2cc(N/C(=N/[C@H]3CCCCN(CC(=O)NCCCCc4ccccc4)C3=O)NC#N)ccc2o1 |
| InChI | InChI=1S/C29H34N6O3/c1-21-17-23-18-24(13-14-26(23)38-21)33-29(32-20-30)34-25-12-6-8-16-35(28(25)37)19-27(36)31-15-7-5-11-22-9-3-2-4-10-22/h2-4,9-10,13-14,17-18,25H,5-8,11-12,15-16,19H2,1H3,(H,31,36)(H2,32,33,34)/t25-/m0/s1 |
| InChIKey | VBXHODSRQQHQHY-VWLOTQADSA-N |
| XLogP | 4.10 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|